C12H17F3N2OS — CID 134229696
2-methyl-N-[(1R)-1-[2-(trifluoromethyl)-4-pyridinyl]ethyl]propane-2-sulfinamide (PubChem CID 134229696) has the molecular formula C12H17F3N2OS and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-[2-(trifluoromethyl)-4-pyridinyl]ethyl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[(1R)-1-[2-(trifluoromethyl)-4-pyridinyl]ethyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 134229696 |
| Molecular Formula | C12H17F3N2OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-methyl-N-[(1R)-1-[2-(trifluoromethyl)-4-pyridinyl]ethyl]propane-2-sulfinamide |
| SMILES | C[C@@H](NS(=O)C(C)(C)C)c1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H17F3N2OS/c1-8(17-19(18)11(2,3)4)9-5-6-16-10(7-9)12(13,14)15/h5-8,17H,1-4H3/t8-,19?/m1/s1 |
| InChIKey | ITEODICUHDQKBB-OZUZKCMBSA-N |
| XLogP | 3.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |