C10H13F3N2 — CID 162617603
N-ethyl-1-[2-(trifluoromethyl)-4-pyridinyl]ethanamine (PubChem CID 162617603) has the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. Its IUPAC name is N-ethyl-1-[2-(trifluoromethyl)-4-pyridinyl]ethanamine.
| Compound Name | N-ethyl-1-[2-(trifluoromethyl)-4-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 162617603 |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | N-ethyl-1-[2-(trifluoromethyl)-4-pyridinyl]ethanamine |
| SMILES | CCNC(C)c1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H13F3N2/c1-3-14-7(2)8-4-5-15-9(6-8)10(11,12)13/h4-7,14H,3H2,1-2H3 |
| InChIKey | WOZNEFZQTJHSCN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |