C11H15F3N2 — CID 66328316
N-ethyl-1-[4-(trifluoromethyl)-2-pyridinyl]propan-2-amine (PubChem CID 66328316) has the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. Its IUPAC name is N-ethyl-1-[4-(trifluoromethyl)-2-pyridinyl]propan-2-amine.
| Compound Name | N-ethyl-1-[4-(trifluoromethyl)-2-pyridinyl]propan-2-amine |
|---|---|
| PubChem CID | 66328316 |
| Molecular Formula | C11H15F3N2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-ethyl-1-[4-(trifluoromethyl)-2-pyridinyl]propan-2-amine |
| SMILES | CCNC(C)Cc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C11H15F3N2/c1-3-15-8(2)6-10-7-9(4-5-16-10)11(12,13)14/h4-5,7-8,15H,3,6H2,1-2H3 |
| InChIKey | XIGUFJGIJJPAQF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |