C17H12F9FeNO2 — CID 169008945
1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(trifluoromethyl)-4-pyridinyl]propane-1,3-diol;iron (PubChem CID 169008945) has the molecular formula C17H12F9FeNO2 and a molecular weight of 489.12 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(trifluoromethyl)-4-pyridinyl]propane-1,3-diol;iron.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(trifluoromethyl)-4-pyridinyl]propane-1,3-diol;iron |
|---|---|
| PubChem CID | 169008945 |
| Molecular Formula | C17H12F9FeNO2 |
| Molecular Weight | 489.12 g/mol |
| Exact Mass | 489.01 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(trifluoromethyl)-4-pyridinyl]propane-1,3-diol;iron |
| SMILES | OC(CC(O)c1ccnc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[Fe] |
| InChI | InChI=1S/C17H12F9NO2.Fe/c18-15(19,20)10-3-9(4-11(6-10)16(21,22)23)13(29)7-12(28)8-1-2-27-14(5-8)17(24,25)26;/h1-6,12-13,28-29H,7H2; |
| InChIKey | NDTNRBQIKCGMAT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.12 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|