C18H12ClF9N2O — CID 156510815
1-[3,5-bis(trifluoromethyl)phenyl]-4-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-3-iminobutan-1-ol (PubChem CID 156510815) has the molecular formula C18H12ClF9N2O and a molecular weight of 478.74 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-4-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-3-iminobutan-1-ol.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-4-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-3-iminobutan-1-ol |
|---|---|
| PubChem CID | 156510815 |
| Molecular Formula | C18H12ClF9N2O |
| Molecular Weight | 478.74 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-4-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-3-iminobutan-1-ol |
| SMILES | [H]/N=C(\Cc1cc(C(F)(F)F)ncc1Cl)CC(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12ClF9N2O/c19-13-7-30-15(18(26,27)28)4-8(13)3-12(29)6-14(31)9-1-10(16(20,21)22)5-11(2-9)17(23,24)25/h1-2,4-5,7,14,29,31H,3,6H2/b29-12+ |
| InChIKey | IQGZXXGFHBDEMB-XKJRVUDJSA-N |
| XLogP | 6.48 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.74 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|