C8H5ClF5N — CID 134683659
4-(chloromethyl)-5-(difluoromethyl)-2-(trifluoromethyl)pyridine (PubChem CID 134683659) has the molecular formula C8H5ClF5N and a molecular weight of 245.58 g/mol. Its IUPAC name is 4-(chloromethyl)-5-(difluoromethyl)-2-(trifluoromethyl)pyridine.
| Compound Name | 4-(chloromethyl)-5-(difluoromethyl)-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134683659 |
| Molecular Formula | C8H5ClF5N |
| Molecular Weight | 245.58 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 4-(chloromethyl)-5-(difluoromethyl)-2-(trifluoromethyl)pyridine |
| SMILES | FC(F)c1cnc(C(F)(F)F)cc1CCl |
| InChI | InChI=1S/C8H5ClF5N/c9-2-4-1-6(8(12,13)14)15-3-5(4)7(10)11/h1,3,7H,2H2 |
| InChIKey | CDBBVHGMDVMMBQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|