C9H7ClF5NO — CID 118843740
[2-(chloromethyl)-3-(difluoromethyl)-6-(trifluoromethyl)-4-pyridinyl]methanol (PubChem CID 118843740) has the molecular formula C9H7ClF5NO and a molecular weight of 275.60 g/mol. Its IUPAC name is [2-(chloromethyl)-3-(difluoromethyl)-6-(trifluoromethyl)-4-pyridinyl]methanol.
| Compound Name | [2-(chloromethyl)-3-(difluoromethyl)-6-(trifluoromethyl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 118843740 |
| Molecular Formula | C9H7ClF5NO |
| Molecular Weight | 275.60 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | [2-(chloromethyl)-3-(difluoromethyl)-6-(trifluoromethyl)-4-pyridinyl]methanol |
| SMILES | OCc1cc(C(F)(F)F)nc(CCl)c1C(F)F |
| InChI | InChI=1S/C9H7ClF5NO/c10-2-5-7(8(11)12)4(3-17)1-6(16-5)9(13,14)15/h1,8,17H,2-3H2 |
| InChIKey | DZKQMMAZDNIDFO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|