C9H5ClF5NO — CID 118832698
2-(chloromethyl)-3-(difluoromethyl)-6-(trifluoromethyl)pyridine-4-carbaldehyde (PubChem CID 118832698) has the molecular formula C9H5ClF5NO and a molecular weight of 273.59 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(difluoromethyl)-6-(trifluoromethyl)pyridine-4-carbaldehyde.
| Compound Name | 2-(chloromethyl)-3-(difluoromethyl)-6-(trifluoromethyl)pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 118832698 |
| Molecular Formula | C9H5ClF5NO |
| Molecular Weight | 273.59 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 2-(chloromethyl)-3-(difluoromethyl)-6-(trifluoromethyl)pyridine-4-carbaldehyde |
| SMILES | O=Cc1cc(C(F)(F)F)nc(CCl)c1C(F)F |
| InChI | InChI=1S/C9H5ClF5NO/c10-2-5-7(8(11)12)4(3-17)1-6(16-5)9(13,14)15/h1,3,8H,2H2 |
| InChIKey | IFALJEFGHWRYCU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|