C9H8ClF2NO — CID 118821330
6-(chloromethyl)-2-(difluoromethyl)-5-methylpyridine-3-carbaldehyde (PubChem CID 118821330) has the molecular formula C9H8ClF2NO and a molecular weight of 219.62 g/mol. Its IUPAC name is 6-(chloromethyl)-2-(difluoromethyl)-5-methylpyridine-3-carbaldehyde.
| Compound Name | 6-(chloromethyl)-2-(difluoromethyl)-5-methylpyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 118821330 |
| Molecular Formula | C9H8ClF2NO |
| Molecular Weight | 219.62 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 6-(chloromethyl)-2-(difluoromethyl)-5-methylpyridine-3-carbaldehyde |
| SMILES | Cc1cc(C=O)c(C(F)F)nc1CCl |
| InChI | InChI=1S/C9H8ClF2NO/c1-5-2-6(4-14)8(9(11)12)13-7(5)3-10/h2,4,9H,3H2,1H3 |
| InChIKey | ILQQWOGLMJXBDA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|