C9H10F2N2O — CID 118820061
6-(aminomethyl)-2-(difluoromethyl)-5-methylpyridine-3-carbaldehyde (PubChem CID 118820061) has the molecular formula C9H10F2N2O and a molecular weight of 200.19 g/mol. Its IUPAC name is 6-(aminomethyl)-2-(difluoromethyl)-5-methylpyridine-3-carbaldehyde.
| Compound Name | 6-(aminomethyl)-2-(difluoromethyl)-5-methylpyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 118820061 |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 6-(aminomethyl)-2-(difluoromethyl)-5-methylpyridine-3-carbaldehyde |
| SMILES | Cc1cc(C=O)c(C(F)F)nc1CN |
| InChI | InChI=1S/C9H10F2N2O/c1-5-2-6(4-14)8(9(10)11)13-7(5)3-12/h2,4,9H,3,12H2,1H3 |
| InChIKey | HCEPWGGLBHMLDF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|