C8H9F2N3O — CID 130107032
6-amino-3-(aminomethyl)-2-(difluoromethyl)pyridine-4-carbaldehyde (PubChem CID 130107032) has the molecular formula C8H9F2N3O and a molecular weight of 201.18 g/mol. Its IUPAC name is 6-amino-3-(aminomethyl)-2-(difluoromethyl)pyridine-4-carbaldehyde.
| Compound Name | 6-amino-3-(aminomethyl)-2-(difluoromethyl)pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 130107032 |
| Molecular Formula | C8H9F2N3O |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 6-amino-3-(aminomethyl)-2-(difluoromethyl)pyridine-4-carbaldehyde |
| SMILES | NCc1c(C=O)cc(N)nc1C(F)F |
| InChI | InChI=1S/C8H9F2N3O/c9-8(10)7-5(2-11)4(3-14)1-6(12)13-7/h1,3,8H,2,11H2,(H2,12,13) |
| InChIKey | ZKKXACKDAOLYJG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|