C9H7F5N2O2 — CID 134671561
2-[6-amino-2-(difluoromethyl)-4-(trifluoromethyl)-3-pyridinyl]acetic acid (PubChem CID 134671561) has the molecular formula C9H7F5N2O2 and a molecular weight of 270.16 g/mol. Its IUPAC name is 2-[6-amino-2-(difluoromethyl)-4-(trifluoromethyl)-3-pyridinyl]acetic acid.
| Compound Name | 2-[6-amino-2-(difluoromethyl)-4-(trifluoromethyl)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134671561 |
| Molecular Formula | C9H7F5N2O2 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-[6-amino-2-(difluoromethyl)-4-(trifluoromethyl)-3-pyridinyl]acetic acid |
| SMILES | Nc1cc(C(F)(F)F)c(CC(=O)O)c(C(F)F)n1 |
| InChI | InChI=1S/C9H7F5N2O2/c10-8(11)7-3(1-6(17)18)4(9(12,13)14)2-5(15)16-7/h2,8H,1H2,(H2,15,16)(H,17,18) |
| InChIKey | IBZQNRSUPXDCMN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |