C9H6ClF5N2O — CID 133084782
5-(aminomethyl)-6-(difluoromethyl)-4-(trifluoromethyl)pyridine-2-carbonyl chloride (PubChem CID 133084782) has the molecular formula C9H6ClF5N2O and a molecular weight of 288.60 g/mol. Its IUPAC name is 5-(aminomethyl)-6-(difluoromethyl)-4-(trifluoromethyl)pyridine-2-carbonyl chloride.
| Compound Name | 5-(aminomethyl)-6-(difluoromethyl)-4-(trifluoromethyl)pyridine-2-carbonyl chloride |
|---|---|
| PubChem CID | 133084782 |
| Molecular Formula | C9H6ClF5N2O |
| Molecular Weight | 288.60 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 5-(aminomethyl)-6-(difluoromethyl)-4-(trifluoromethyl)pyridine-2-carbonyl chloride |
| SMILES | NCc1c(C(F)(F)F)cc(C(=O)Cl)nc1C(F)F |
| InChI | InChI=1S/C9H6ClF5N2O/c10-7(18)5-1-4(9(13,14)15)3(2-16)6(17-5)8(11)12/h1,8H,2,16H2 |
| InChIKey | PECBCFAMOYMHNX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|