C8H7F2IN2O2 — CID 130086964
5-(aminomethyl)-6-(difluoromethyl)-4-iodopyridine-2-carboxylic acid (PubChem CID 130086964) has the molecular formula C8H7F2IN2O2 and a molecular weight of 328.06 g/mol. Its IUPAC name is 5-(aminomethyl)-6-(difluoromethyl)-4-iodopyridine-2-carboxylic acid.
| Compound Name | 5-(aminomethyl)-6-(difluoromethyl)-4-iodopyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 130086964 |
| Molecular Formula | C8H7F2IN2O2 |
| Molecular Weight | 328.06 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 5-(aminomethyl)-6-(difluoromethyl)-4-iodopyridine-2-carboxylic acid |
| SMILES | NCc1c(I)cc(C(=O)O)nc1C(F)F |
| InChI | InChI=1S/C8H7F2IN2O2/c9-7(10)6-3(2-12)4(11)1-5(13-6)8(14)15/h1,7H,2,12H2,(H,14,15) |
| InChIKey | XCRURSFSYOYUHC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.06 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|