C8H7ClF2N2O — CID 130107562
4-amino-5-(chloromethyl)-6-(difluoromethyl)pyridine-2-carbaldehyde (PubChem CID 130107562) has the molecular formula C8H7ClF2N2O and a molecular weight of 220.61 g/mol. Its IUPAC name is 4-amino-5-(chloromethyl)-6-(difluoromethyl)pyridine-2-carbaldehyde.
| Compound Name | 4-amino-5-(chloromethyl)-6-(difluoromethyl)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 130107562 |
| Molecular Formula | C8H7ClF2N2O |
| Molecular Weight | 220.61 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 4-amino-5-(chloromethyl)-6-(difluoromethyl)pyridine-2-carbaldehyde |
| SMILES | Nc1cc(C=O)nc(C(F)F)c1CCl |
| InChI | InChI=1S/C8H7ClF2N2O/c9-2-5-6(12)1-4(3-14)13-7(5)8(10)11/h1,3,8H,2H2,(H2,12,13) |
| InChIKey | JEWBWHHFPCTSKJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.61 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|