C9H5ClF2O2 — CID 171007894
5-chloro-2-(difluoromethyl)benzene-1,3-dicarbaldehyde (PubChem CID 171007894) has the molecular formula C9H5ClF2O2 and a molecular weight of 218.59 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)benzene-1,3-dicarbaldehyde.
| Compound Name | 5-chloro-2-(difluoromethyl)benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 171007894 |
| Molecular Formula | C9H5ClF2O2 |
| Molecular Weight | 218.59 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)benzene-1,3-dicarbaldehyde |
| SMILES | O=Cc1cc(Cl)cc(C=O)c1C(F)F |
| InChI | InChI=1S/C9H5ClF2O2/c10-7-1-5(3-13)8(9(11)12)6(2-7)4-14/h1-4,9H |
| InChIKey | ATEZSDZRGDXIJV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|