C7H3Cl2F3 — CID 119004483
1,5-dichloro-2-(difluoromethyl)-3-fluorobenzene (PubChem CID 119004483) has the molecular formula C7H3Cl2F3 and a molecular weight of 215.00 g/mol. Its IUPAC name is 1,5-dichloro-2-(difluoromethyl)-3-fluorobenzene.
| Compound Name | 1,5-dichloro-2-(difluoromethyl)-3-fluorobenzene |
|---|---|
| PubChem CID | 119004483 |
| Molecular Formula | C7H3Cl2F3 |
| Molecular Weight | 215.00 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | 1,5-dichloro-2-(difluoromethyl)-3-fluorobenzene |
| SMILES | Fc1cc(Cl)cc(Cl)c1C(F)F |
| InChI | InChI=1S/C7H3Cl2F3/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,7H |
| InChIKey | VCOVJFYKTARMTE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.00 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |