C13H7Cl3F2O2 — CID 86576202
3-chloro-6-(2,4-dichlorophenoxy)-2-(difluoromethyl)phenol (PubChem CID 86576202) has the molecular formula C13H7Cl3F2O2 and a molecular weight of 339.55 g/mol. Its IUPAC name is 3-chloro-6-(2,4-dichlorophenoxy)-2-(difluoromethyl)phenol.
| Compound Name | 3-chloro-6-(2,4-dichlorophenoxy)-2-(difluoromethyl)phenol |
|---|---|
| PubChem CID | 86576202 |
| Molecular Formula | C13H7Cl3F2O2 |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 337.95 |
| IUPAC Name | 3-chloro-6-(2,4-dichlorophenoxy)-2-(difluoromethyl)phenol |
| SMILES | Oc1c(Oc2ccc(Cl)cc2Cl)ccc(Cl)c1C(F)F |
| InChI | InChI=1S/C13H7Cl3F2O2/c14-6-1-3-9(8(16)5-6)20-10-4-2-7(15)11(12(10)19)13(17)18/h1-5,13,19H |
| InChIKey | SCPNDLMPSJOEKL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |