C15H11ClF5N — CID 155385706
3-(chloromethyl)-2-(1,1-difluoroethyl)-5-[3-(difluoromethyl)-4-fluorophenyl]pyridine (PubChem CID 155385706) has the molecular formula C15H11ClF5N and a molecular weight of 335.70 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(1,1-difluoroethyl)-5-[3-(difluoromethyl)-4-fluorophenyl]pyridine.
| Compound Name | 3-(chloromethyl)-2-(1,1-difluoroethyl)-5-[3-(difluoromethyl)-4-fluorophenyl]pyridine |
|---|---|
| PubChem CID | 155385706 |
| Molecular Formula | C15H11ClF5N |
| Molecular Weight | 335.70 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 3-(chloromethyl)-2-(1,1-difluoroethyl)-5-[3-(difluoromethyl)-4-fluorophenyl]pyridine |
| SMILES | CC(F)(F)c1ncc(-c2ccc(F)c(C(F)F)c2)cc1CCl |
| InChI | InChI=1S/C15H11ClF5N/c1-15(20,21)13-9(6-16)4-10(7-22-13)8-2-3-12(17)11(5-8)14(18)19/h2-5,7,14H,6H2,1H3 |
| InChIKey | PLFMKMIHRWFVPU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.70 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|