C11H17BrN2OS — CID 59278411
(R)-N-[(1S)-1-(2-bromo-4-pyridinyl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 59278411) has the molecular formula C11H17BrN2OS and a molecular weight of 305.24 g/mol. Its IUPAC name is (R)-N-[(1S)-1-(2-bromo-4-pyridinyl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S)-1-(2-bromo-4-pyridinyl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 59278411 |
| Molecular Formula | C11H17BrN2OS |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (R)-N-[(1S)-1-(2-bromo-4-pyridinyl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | C[C@H](N[S@](=O)C(C)(C)C)c1ccnc(Br)c1 |
| InChI | InChI=1S/C11H17BrN2OS/c1-8(14-16(15)11(2,3)4)9-5-6-13-10(12)7-9/h5-8,14H,1-4H3/t8-,16+/m0/s1 |
| InChIKey | PXPOIESCMRNWJW-ZKANADHPSA-N |
| XLogP | 2.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|