C13H20BrNO2S — CID 176890367
(R)-N-[(1S)-1-(4-bromo-3-methoxyphenyl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 176890367) has the molecular formula C13H20BrNO2S and a molecular weight of 334.28 g/mol. Its IUPAC name is (R)-N-[(1S)-1-(4-bromo-3-methoxyphenyl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S)-1-(4-bromo-3-methoxyphenyl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 176890367 |
| Molecular Formula | C13H20BrNO2S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | (R)-N-[(1S)-1-(4-bromo-3-methoxyphenyl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | COc1cc([C@H](C)N[S@](=O)C(C)(C)C)ccc1Br |
| InChI | InChI=1S/C13H20BrNO2S/c1-9(15-18(16)13(2,3)4)10-6-7-11(14)12(8-10)17-5/h6-9,15H,1-5H3/t9-,18+/m0/s1 |
| InChIKey | XPPGVIODWHIVEE-NIVTXAMTSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |