C14H22BrNO3S — CID 170329482
(R)-N-[(1S)-1-[4-bromo-2-(methoxymethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 170329482) has the molecular formula C14H22BrNO3S and a molecular weight of 364.31 g/mol. Its IUPAC name is (R)-N-[(1S)-1-[4-bromo-2-(methoxymethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S)-1-[4-bromo-2-(methoxymethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 170329482 |
| Molecular Formula | C14H22BrNO3S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (R)-N-[(1S)-1-[4-bromo-2-(methoxymethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | COCOc1cc(Br)ccc1[C@H](C)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C14H22BrNO3S/c1-10(16-20(17)14(2,3)4)12-7-6-11(15)8-13(12)19-9-18-5/h6-8,10,16H,9H2,1-5H3/t10-,20+/m0/s1 |
| InChIKey | GNAMRKOQUSTOOC-WVDJIFEKSA-N |
| XLogP | 3.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|