C14H20BrNO3S — CID 170329219
(NE,R)-N-[1-[4-bromo-2-(methoxymethoxy)phenyl]ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 170329219) has the molecular formula C14H20BrNO3S and a molecular weight of 362.29 g/mol. Its IUPAC name is (NE,R)-N-[1-[4-bromo-2-(methoxymethoxy)phenyl]ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[1-[4-bromo-2-(methoxymethoxy)phenyl]ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 170329219 |
| Molecular Formula | C14H20BrNO3S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | (NE,R)-N-[1-[4-bromo-2-(methoxymethoxy)phenyl]ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | COCOc1cc(Br)ccc1/C(C)=N/[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C14H20BrNO3S/c1-10(16-20(17)14(2,3)4)12-7-6-11(15)8-13(12)19-9-18-5/h6-8H,9H2,1-5H3/b16-10+/t20-/m1/s1 |
| InChIKey | YAORUIDOHMZECH-NXZBIGBUSA-N |
| XLogP | 3.70 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|