C19H17F3N2O6 — CID 142117354
(2S)-2-hydroxy-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-(4-propanoylphenoxy)propanamide (PubChem CID 142117354) has the molecular formula C19H17F3N2O6 and a molecular weight of 426.35 g/mol. Its IUPAC name is (2S)-2-hydroxy-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-(4-propanoylphenoxy)propanamide.
| Compound Name | (2S)-2-hydroxy-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-(4-propanoylphenoxy)propanamide |
|---|---|
| PubChem CID | 142117354 |
| Molecular Formula | C19H17F3N2O6 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (2S)-2-hydroxy-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-(4-propanoylphenoxy)propanamide |
| SMILES | CCC(=O)c1ccc(OC[C@H](O)C(=O)Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H17F3N2O6/c1-2-16(25)11-3-6-13(7-4-11)30-10-17(26)18(27)23-12-5-8-15(24(28)29)14(9-12)19(20,21)22/h3-9,17,26H,2,10H2,1H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | XFMIQKKUUPXZRC-KRWDZBQOSA-N |
| XLogP | 3.58 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|