C16H12BrF4NO3 — CID 142885767
(2S)-N-[4-bromo-3-(trifluoromethyl)phenyl]-3-(4-fluorophenoxy)-2-hydroxypropanamide (PubChem CID 142885767) has the molecular formula C16H12BrF4NO3 and a molecular weight of 422.17 g/mol. Its IUPAC name is (2S)-N-[4-bromo-3-(trifluoromethyl)phenyl]-3-(4-fluorophenoxy)-2-hydroxypropanamide.
| Compound Name | (2S)-N-[4-bromo-3-(trifluoromethyl)phenyl]-3-(4-fluorophenoxy)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 142885767 |
| Molecular Formula | C16H12BrF4NO3 |
| Molecular Weight | 422.17 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | (2S)-N-[4-bromo-3-(trifluoromethyl)phenyl]-3-(4-fluorophenoxy)-2-hydroxypropanamide |
| SMILES | O=C(Nc1ccc(Br)c(C(F)(F)F)c1)[C@@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C16H12BrF4NO3/c17-13-6-3-10(7-12(13)16(19,20)21)22-15(24)14(23)8-25-11-4-1-9(18)2-5-11/h1-7,14,23H,8H2,(H,22,24)/t14-/m0/s1 |
| InChIKey | UYRPXCCCPVTGQN-AWEZNQCLSA-N |
| XLogP | 3.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |