C16H12F4INO3 — CID 142885780
(2S)-3-(4-fluorophenoxy)-2-hydroxy-N-[4-iodo-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 142885780) has the molecular formula C16H12F4INO3 and a molecular weight of 469.17 g/mol. Its IUPAC name is (2S)-3-(4-fluorophenoxy)-2-hydroxy-N-[4-iodo-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-3-(4-fluorophenoxy)-2-hydroxy-N-[4-iodo-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 142885780 |
| Molecular Formula | C16H12F4INO3 |
| Molecular Weight | 469.17 g/mol |
| Exact Mass | 468.98 |
| IUPAC Name | (2S)-3-(4-fluorophenoxy)-2-hydroxy-N-[4-iodo-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(Nc1ccc(I)c(C(F)(F)F)c1)[C@@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C16H12F4INO3/c17-9-1-4-11(5-2-9)25-8-14(23)15(24)22-10-3-6-13(21)12(7-10)16(18,19)20/h1-7,14,23H,8H2,(H,22,24)/t14-/m0/s1 |
| InChIKey | QJFFEVTZRXMDDU-AWEZNQCLSA-N |
| XLogP | 3.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.17 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|