C17H10F4N2O3 — CID 143610755
N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenoxy)-2-oxopropanamide (PubChem CID 143610755) has the molecular formula C17H10F4N2O3 and a molecular weight of 366.27 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenoxy)-2-oxopropanamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenoxy)-2-oxopropanamide |
|---|---|
| PubChem CID | 143610755 |
| Molecular Formula | C17H10F4N2O3 |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenoxy)-2-oxopropanamide |
| SMILES | N#Cc1ccc(NC(=O)C(=O)COc2ccc(F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H10F4N2O3/c18-11-2-5-13(6-3-11)26-9-15(24)16(25)23-12-4-1-10(8-22)14(7-12)17(19,20)21/h1-7H,9H2,(H,23,25) |
| InChIKey | CNXRZEIIRZYNLC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|