C22H25F3N4O2 — CID 71566634
N-[4-cyano-3-(trifluoromethyl)phenyl]-2-[4-[2-(dimethylamino)ethoxy]anilino]-2-methylpropanamide (PubChem CID 71566634) has the molecular formula C22H25F3N4O2 and a molecular weight of 434.46 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-2-[4-[2-(dimethylamino)ethoxy]anilino]-2-methylpropanamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-[4-[2-(dimethylamino)ethoxy]anilino]-2-methylpropanamide |
|---|---|
| PubChem CID | 71566634 |
| Molecular Formula | C22H25F3N4O2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-[4-[2-(dimethylamino)ethoxy]anilino]-2-methylpropanamide |
| SMILES | CN(C)CCOc1ccc(NC(C)(C)C(=O)Nc2ccc(C#N)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H25F3N4O2/c1-21(2,28-16-7-9-18(10-8-16)31-12-11-29(3)4)20(30)27-17-6-5-15(14-26)19(13-17)22(23,24)25/h5-10,13,28H,11-12H2,1-4H3,(H,27,30) |
| InChIKey | PFMDAUKKGATIBK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|