C19H18F4N4O — CID 18753317
1-[4-[4-cyano-3-(trifluoromethyl)anilino]butyl]-3-(4-fluorophenyl)urea (PubChem CID 18753317) has the molecular formula C19H18F4N4O and a molecular weight of 394.37 g/mol. Its IUPAC name is 1-[4-[4-cyano-3-(trifluoromethyl)anilino]butyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[4-[4-cyano-3-(trifluoromethyl)anilino]butyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 18753317 |
| Molecular Formula | C19H18F4N4O |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-[4-[4-cyano-3-(trifluoromethyl)anilino]butyl]-3-(4-fluorophenyl)urea |
| SMILES | N#Cc1ccc(NCCCCNC(=O)Nc2ccc(F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H18F4N4O/c20-14-4-7-15(8-5-14)27-18(28)26-10-2-1-9-25-16-6-3-13(12-24)17(11-16)19(21,22)23/h3-8,11,25H,1-2,9-10H2,(H2,26,27,28) |
| InChIKey | PVGGVBNJBGPNAX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|