C19H15ClFNO3 — CID 134044267
(5-chloro-1-benzofuran-2-yl)-[2-(4-fluorophenyl)morpholin-4-yl]methanone (PubChem CID 134044267) has the molecular formula C19H15ClFNO3 and a molecular weight of 359.78 g/mol. Its IUPAC name is (5-chloro-1-benzofuran-2-yl)-[2-(4-fluorophenyl)morpholin-4-yl]methanone.
| Compound Name | (5-chloro-1-benzofuran-2-yl)-[2-(4-fluorophenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 134044267 |
| Molecular Formula | C19H15ClFNO3 |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (5-chloro-1-benzofuran-2-yl)-[2-(4-fluorophenyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1cc2cc(Cl)ccc2o1)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H15ClFNO3/c20-14-3-6-16-13(9-14)10-17(25-16)19(23)22-7-8-24-18(11-22)12-1-4-15(21)5-2-12/h1-6,9-10,18H,7-8,11H2 |
| InChIKey | DPRHOYHWRBGHDN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |