C15H14ClNO5 — CID 119247536
2-[4-(5-chloro-1-benzofuran-2-carbonyl)morpholin-2-yl]acetic acid (PubChem CID 119247536) has the molecular formula C15H14ClNO5 and a molecular weight of 323.73 g/mol. Its IUPAC name is 2-[4-(5-chloro-1-benzofuran-2-carbonyl)morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-(5-chloro-1-benzofuran-2-carbonyl)morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119247536 |
| Molecular Formula | C15H14ClNO5 |
| Molecular Weight | 323.73 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-[4-(5-chloro-1-benzofuran-2-carbonyl)morpholin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)c2cc3cc(Cl)ccc3o2)CCO1 |
| InChI | InChI=1S/C15H14ClNO5/c16-10-1-2-12-9(5-10)6-13(22-12)15(20)17-3-4-21-11(8-17)7-14(18)19/h1-2,5-6,11H,3-4,7-8H2,(H,18,19) |
| InChIKey | VNKWWNINZWNCOK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.73 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |