C14H15ClN4O2 — CID 95556703
(3-amino-1H-pyrazol-5-yl)-[(2R)-2-(4-chlorophenyl)morpholin-4-yl]methanone (PubChem CID 95556703) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is (3-amino-1H-pyrazol-5-yl)-[(2R)-2-(4-chlorophenyl)morpholin-4-yl]methanone.
| Compound Name | (3-amino-1H-pyrazol-5-yl)-[(2R)-2-(4-chlorophenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 95556703 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (3-amino-1H-pyrazol-5-yl)-[(2R)-2-(4-chlorophenyl)morpholin-4-yl]methanone |
| SMILES | Nc1cc(C(=O)N2CCO[C@H](c3ccc(Cl)cc3)C2)[nH]n1 |
| InChI | InChI=1S/C14H15ClN4O2/c15-10-3-1-9(2-4-10)12-8-19(5-6-21-12)14(20)11-7-13(16)18-17-11/h1-4,7,12H,5-6,8H2,(H3,16,17,18)/t12-/m0/s1 |
| InChIKey | LGCOSULCKWFYNX-LBPRGKRZSA-N |
| XLogP | 1.86 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |