C31H33ClF6N4O5 — CID 90149966
1-[4-[1-[3-chloro-5-(trifluoromethyl)-1-benzofuran-2-yl]ethyl]piperazin-1-yl]-2-[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 90149966) has the molecular formula C31H33ClF6N4O5 and a molecular weight of 691.07 g/mol. Its IUPAC name is 1-[4-[1-[3-chloro-5-(trifluoromethyl)-1-benzofuran-2-yl]ethyl]piperazin-1-yl]-2-[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-[1-[3-chloro-5-(trifluoromethyl)-1-benzofuran-2-yl]ethyl]piperazin-1-yl]-2-[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 90149966 |
| Molecular Formula | C31H33ClF6N4O5 |
| Molecular Weight | 691.07 g/mol |
| Exact Mass | 690.20 |
| IUPAC Name | 1-[4-[1-[3-chloro-5-(trifluoromethyl)-1-benzofuran-2-yl]ethyl]piperazin-1-yl]-2-[4-[N-methyl-4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | CC(c1oc2ccc(C(F)(F)F)cc2c1Cl)N1CCN(C(=O)COC2CCC(N(C)c3ccc([N+](=O)[O-])c(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C31H33ClF6N4O5/c1-18(29-28(32)23-15-19(30(33,34)35)3-10-26(23)47-29)40-11-13-41(14-12-40)27(43)17-46-22-7-4-20(5-8-22)39(2)21-6-9-25(42(44)45)24(16-21)31(36,37)38/h3,6,9-10,15-16,18,20,22H,4-5,7-8,11-14,17H2,1-2H3 |
| InChIKey | KDUCVVDGZUFYHN-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.07 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|