C13H14F3N3O4 — CID 146350646
N-(ethylcarbamoyl)-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 146350646) has the molecular formula C13H14F3N3O4 and a molecular weight of 333.27 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-(ethylcarbamoyl)-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 146350646 |
| Molecular Formula | C13H14F3N3O4 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-(ethylcarbamoyl)-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCNC(=O)N(C(=O)CC)c1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F3N3O4/c1-3-11(20)18(12(21)17-4-2)8-5-6-10(19(22)23)9(7-8)13(14,15)16/h5-7H,3-4H2,1-2H3,(H,17,21) |
| InChIKey | JSHZKNPZYBTIHT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|