C12H13F3N2O5 — CID 126600468
(2S)-2-hydroxy-2-[[4-nitro-3-(trifluoromethyl)anilino]methyl]butanoic acid (PubChem CID 126600468) has the molecular formula C12H13F3N2O5 and a molecular weight of 322.24 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-[[4-nitro-3-(trifluoromethyl)anilino]methyl]butanoic acid.
| Compound Name | (2S)-2-hydroxy-2-[[4-nitro-3-(trifluoromethyl)anilino]methyl]butanoic acid |
|---|---|
| PubChem CID | 126600468 |
| Molecular Formula | C12H13F3N2O5 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (2S)-2-hydroxy-2-[[4-nitro-3-(trifluoromethyl)anilino]methyl]butanoic acid |
| SMILES | CC[C@](O)(CNc1ccc([N+](=O)[O-])c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C12H13F3N2O5/c1-2-11(20,10(18)19)6-16-7-3-4-9(17(21)22)8(5-7)12(13,14)15/h3-5,16,20H,2,6H2,1H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | UUMVTVMEGRSBHJ-NSHDSACASA-N |
| XLogP | 2.25 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|