C14H15F3N4O3 — CID 133340806
2-(1-methylpyrazol-4-yl)-1-[4-nitro-3-(trifluoromethyl)anilino]propan-2-ol (PubChem CID 133340806) has the molecular formula C14H15F3N4O3 and a molecular weight of 344.29 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-1-[4-nitro-3-(trifluoromethyl)anilino]propan-2-ol.
| Compound Name | 2-(1-methylpyrazol-4-yl)-1-[4-nitro-3-(trifluoromethyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 133340806 |
| Molecular Formula | C14H15F3N4O3 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-1-[4-nitro-3-(trifluoromethyl)anilino]propan-2-ol |
| SMILES | Cn1cc(C(C)(O)CNc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C14H15F3N4O3/c1-13(22,9-6-19-20(2)7-9)8-18-10-3-4-12(21(23)24)11(5-10)14(15,16)17/h3-7,18,22H,8H2,1-2H3 |
| InChIKey | XIWNEWCOKUUDFG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|