C15H11ClF3N3O4 — CID 15405297
N-[(2-chlorophenyl)methyl]-N-methyl-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 15405297) has the molecular formula C15H11ClF3N3O4 and a molecular weight of 389.72 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-methyl-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-methyl-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 15405297 |
| Molecular Formula | C15H11ClF3N3O4 |
| Molecular Weight | 389.72 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-methyl-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | CN(Cc1ccccc1Cl)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11ClF3N3O4/c1-20(8-9-4-2-3-5-11(9)16)14-12(21(23)24)6-10(15(17,18)19)7-13(14)22(25)26/h2-7H,8H2,1H3 |
| InChIKey | URHMZQLOTRWMMS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|