C13H8F3N3O4 — CID 160794916
2,6-dinitro-N,N-bis(prop-2-ynyl)-4-(trifluoromethyl)aniline (PubChem CID 160794916) has the molecular formula C13H8F3N3O4 and a molecular weight of 327.22 g/mol. Its IUPAC name is 2,6-dinitro-N,N-bis(prop-2-ynyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2,6-dinitro-N,N-bis(prop-2-ynyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 160794916 |
| Molecular Formula | C13H8F3N3O4 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2,6-dinitro-N,N-bis(prop-2-ynyl)-4-(trifluoromethyl)aniline |
| SMILES | C#CCN(CC#C)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H8F3N3O4/c1-3-5-17(6-4-2)12-10(18(20)21)7-9(13(14,15)16)8-11(12)19(22)23/h1-2,7-8H,5-6H2 |
| InChIKey | SCHVKQKHFSSMLP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|