C25H27Cl2F3N4O5 — CID 57384109
N-butyl-N-ethyl-2,6-dinitro-4-(trifluoromethyl)aniline;3,5-dichloro-N-(2-methylbut-3-yn-2-yl)benzamide (PubChem CID 57384109) has the molecular formula C25H27Cl2F3N4O5 and a molecular weight of 591.41 g/mol. Its IUPAC name is N-butyl-N-ethyl-2,6-dinitro-4-(trifluoromethyl)aniline;3,5-dichloro-N-(2-methylbut-3-yn-2-yl)benzamide.
| Compound Name | N-butyl-N-ethyl-2,6-dinitro-4-(trifluoromethyl)aniline;3,5-dichloro-N-(2-methylbut-3-yn-2-yl)benzamide |
|---|---|
| PubChem CID | 57384109 |
| Molecular Formula | C25H27Cl2F3N4O5 |
| Molecular Weight | 591.41 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | N-butyl-N-ethyl-2,6-dinitro-4-(trifluoromethyl)aniline;3,5-dichloro-N-(2-methylbut-3-yn-2-yl)benzamide |
| SMILES | C#CC(C)(C)NC(=O)c1cc(Cl)cc(Cl)c1.CCCCN(CC)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16F3N3O4.C12H11Cl2NO/c1-3-5-6-17(4-2)12-10(18(20)21)7-9(13(14,15)16)8-11(12)19(22)23;1-4-12(2,3)15-11(16)8-5-9(13)7-10(14)6-8/h7-8H,3-6H2,1-2H3;1,5-7H,2-3H3,(H,15,16) |
| InChIKey | AMZWIXUIAJUVRK-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.41 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|