C11H16N4O7S2 — CID 71777137
2-(dimethylamino)-5-[ethyl(methylsulfanylsulfonyloxy)amino]-1,3-dinitrobenzene (PubChem CID 71777137) has the molecular formula C11H16N4O7S2 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-(dimethylamino)-5-[ethyl(methylsulfanylsulfonyloxy)amino]-1,3-dinitrobenzene.
| Compound Name | 2-(dimethylamino)-5-[ethyl(methylsulfanylsulfonyloxy)amino]-1,3-dinitrobenzene |
|---|---|
| PubChem CID | 71777137 |
| Molecular Formula | C11H16N4O7S2 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-(dimethylamino)-5-[ethyl(methylsulfanylsulfonyloxy)amino]-1,3-dinitrobenzene |
| SMILES | CCN(OS(=O)(=O)SC)c1cc([N+](=O)[O-])c(N(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H16N4O7S2/c1-5-13(22-24(20,21)23-4)8-6-9(14(16)17)11(12(2)3)10(7-8)15(18)19/h6-7H,5H2,1-4H3 |
| InChIKey | RMQSSARNEIASCC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|