C13H19N3O4 — CID 20563849
3-butan-2-yl-N,N,4-trimethyl-2,6-dinitroaniline (PubChem CID 20563849) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-butan-2-yl-N,N,4-trimethyl-2,6-dinitroaniline.
| Compound Name | 3-butan-2-yl-N,N,4-trimethyl-2,6-dinitroaniline |
|---|---|
| PubChem CID | 20563849 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-butan-2-yl-N,N,4-trimethyl-2,6-dinitroaniline |
| SMILES | CCC(C)c1c(C)cc([N+](=O)[O-])c(N(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O4/c1-6-8(2)11-9(3)7-10(15(17)18)12(14(4)5)13(11)16(19)20/h7-8H,6H2,1-5H3 |
| InChIKey | ISPAKJHZUBOTIL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|