C18H15N5O6 — CID 5234949
N,N-dimethyl-4-(8-methyl-5-nitroquinolin-2-yl)-2,6-dinitroaniline (PubChem CID 5234949) has the molecular formula C18H15N5O6 and a molecular weight of 397.35 g/mol. Its IUPAC name is N,N-dimethyl-4-(8-methyl-5-nitroquinolin-2-yl)-2,6-dinitroaniline.
| Compound Name | N,N-dimethyl-4-(8-methyl-5-nitroquinolin-2-yl)-2,6-dinitroaniline |
|---|---|
| PubChem CID | 5234949 |
| Molecular Formula | C18H15N5O6 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N,N-dimethyl-4-(8-methyl-5-nitroquinolin-2-yl)-2,6-dinitroaniline |
| SMILES | Cc1ccc([N+](=O)[O-])c2ccc(-c3cc([N+](=O)[O-])c(N(C)C)c([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C18H15N5O6/c1-10-4-7-14(21(24)25)12-5-6-13(19-17(10)12)11-8-15(22(26)27)18(20(2)3)16(9-11)23(28)29/h4-9H,1-3H3 |
| InChIKey | SPFOJHRQYLFUMN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 145.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|