C15H11N3O4 — CID 21159480
2,4-dimethyl-8,9-dinitrobenzo[h]quinoline (PubChem CID 21159480) has the molecular formula C15H11N3O4 and a molecular weight of 297.27 g/mol. Its IUPAC name is 2,4-dimethyl-8,9-dinitrobenzo[h]quinoline.
| Compound Name | 2,4-dimethyl-8,9-dinitrobenzo[h]quinoline |
|---|---|
| PubChem CID | 21159480 |
| Molecular Formula | C15H11N3O4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2,4-dimethyl-8,9-dinitrobenzo[h]quinoline |
| SMILES | Cc1cc(C)c2ccc3cc([N+](=O)[O-])c([N+](=O)[O-])cc3c2n1 |
| InChI | InChI=1S/C15H11N3O4/c1-8-5-9(2)16-15-11(8)4-3-10-6-13(17(19)20)14(18(21)22)7-12(10)15/h3-7H,1-2H3 |
| InChIKey | MPZZLSZZAKYOBI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|