C9H9N5O4S — CID 113366463
3-(4-methyl-3-nitrophenyl)-1H-1,2,4-triazole-5-sulfonamide (PubChem CID 113366463) has the molecular formula C9H9N5O4S and a molecular weight of 283.27 g/mol. Its IUPAC name is 3-(4-methyl-3-nitrophenyl)-1H-1,2,4-triazole-5-sulfonamide.
| Compound Name | 3-(4-methyl-3-nitrophenyl)-1H-1,2,4-triazole-5-sulfonamide |
|---|---|
| PubChem CID | 113366463 |
| Molecular Formula | C9H9N5O4S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 3-(4-methyl-3-nitrophenyl)-1H-1,2,4-triazole-5-sulfonamide |
| SMILES | Cc1ccc(-c2n[nH]c(S(N)(=O)=O)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N5O4S/c1-5-2-3-6(4-7(5)14(15)16)8-11-9(13-12-8)19(10,17)18/h2-4H,1H3,(H2,10,17,18)(H,11,12,13) |
| InChIKey | VJZPRTUFRBUVCP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|