C16H15N5O3 — CID 136902677
4-[5-[(S)-amino-(4-methylphenyl)methyl]-1H-1,2,4-triazol-3-yl]-2-nitrophenol (PubChem CID 136902677) has the molecular formula C16H15N5O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is 4-[5-[(S)-amino-(4-methylphenyl)methyl]-1H-1,2,4-triazol-3-yl]-2-nitrophenol.
| Compound Name | 4-[5-[(S)-amino-(4-methylphenyl)methyl]-1H-1,2,4-triazol-3-yl]-2-nitrophenol |
|---|---|
| PubChem CID | 136902677 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-[5-[(S)-amino-(4-methylphenyl)methyl]-1H-1,2,4-triazol-3-yl]-2-nitrophenol |
| SMILES | Cc1ccc([C@H](N)c2nc(-c3ccc(O)c([N+](=O)[O-])c3)n[nH]2)cc1 |
| InChI | InChI=1S/C16H15N5O3/c1-9-2-4-10(5-3-9)14(17)16-18-15(19-20-16)11-6-7-13(22)12(8-11)21(23)24/h2-8,14,22H,17H2,1H3,(H,18,19,20)/t14-/m0/s1 |
| InChIKey | DPMLYKNKGRVAFR-AWEZNQCLSA-N |
| XLogP | 2.44 |
| TPSA | 130.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|