C16H14ClN5O3 — CID 97287823
(S)-(4-chlorophenyl)-[3-(4-methoxy-3-nitrophenyl)-1H-1,2,4-triazol-5-yl]methanamine (PubChem CID 97287823) has the molecular formula C16H14ClN5O3 and a molecular weight of 359.77 g/mol. Its IUPAC name is (S)-(4-chlorophenyl)-[3-(4-methoxy-3-nitrophenyl)-1H-1,2,4-triazol-5-yl]methanamine.
| Compound Name | (S)-(4-chlorophenyl)-[3-(4-methoxy-3-nitrophenyl)-1H-1,2,4-triazol-5-yl]methanamine |
|---|---|
| PubChem CID | 97287823 |
| Molecular Formula | C16H14ClN5O3 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (S)-(4-chlorophenyl)-[3-(4-methoxy-3-nitrophenyl)-1H-1,2,4-triazol-5-yl]methanamine |
| SMILES | COc1ccc(-c2n[nH]c([C@@H](N)c3ccc(Cl)cc3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14ClN5O3/c1-25-13-7-4-10(8-12(13)22(23)24)15-19-16(21-20-15)14(18)9-2-5-11(17)6-3-9/h2-8,14H,18H2,1H3,(H,19,20,21)/t14-/m0/s1 |
| InChIKey | QAPRMNWNNJVQEI-AWEZNQCLSA-N |
| XLogP | 3.09 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|