C14H15N5O2 — CID 20646277
2-(4-methyl-3-nitrophenyl)-6-propan-2-yl-5H-pyrazolo[1,5-b][1,2,4]triazole (PubChem CID 20646277) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-(4-methyl-3-nitrophenyl)-6-propan-2-yl-5H-pyrazolo[1,5-b][1,2,4]triazole.
| Compound Name | 2-(4-methyl-3-nitrophenyl)-6-propan-2-yl-5H-pyrazolo[1,5-b][1,2,4]triazole |
|---|---|
| PubChem CID | 20646277 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-(4-methyl-3-nitrophenyl)-6-propan-2-yl-5H-pyrazolo[1,5-b][1,2,4]triazole |
| SMILES | Cc1ccc(-c2nc3cc(C(C)C)[nH]n3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15N5O2/c1-8(2)11-7-13-15-14(17-18(13)16-11)10-5-4-9(3)12(6-10)19(20)21/h4-8,16H,1-3H3 |
| InChIKey | QOUQDFYQQXNQRC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|