C14H11N5O2 — CID 43826489
3-[5-(3-methyl-4-nitrophenyl)-1H-1,2,4-triazol-3-yl]pyridine (PubChem CID 43826489) has the molecular formula C14H11N5O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is 3-[5-(3-methyl-4-nitrophenyl)-1H-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 3-[5-(3-methyl-4-nitrophenyl)-1H-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 43826489 |
| Molecular Formula | C14H11N5O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-[5-(3-methyl-4-nitrophenyl)-1H-1,2,4-triazol-3-yl]pyridine |
| SMILES | Cc1cc(-c2nc(-c3cccnc3)n[nH]2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11N5O2/c1-9-7-10(4-5-12(9)19(20)21)13-16-14(18-17-13)11-3-2-6-15-8-11/h2-8H,1H3,(H,16,17,18) |
| InChIKey | WFKSGWKBBMMTET-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|