4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid

C14H10N4O2 — CID 177307387

IUPAC4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid
SMILESO=C(O)c1ccc(-c2nc(-c3cccnc3)n[nH]2)cc1
InChIInChI=1S/C14H10N4O2/c19-14(20)10-5-3-9(4-6-10)12-16-13(18-17-12)11-2-1-7-15-8-11/h1-8H,(H,19,20)(H,16,17,18)
InChIKeyWEHIIWRXQQOVSY-UHFFFAOYSA-N
MW266.26 g/mol
LogP2.23
Rot. Bonds3

About 4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid

4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid (PubChem CID 177307387) has the molecular formula C14H10N4O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid.

Molecular Properties

Compound Name4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid
PubChem CID177307387
Molecular FormulaC14H10N4O2
Molecular Weight266.26 g/mol
Exact Mass266.08
IUPAC Name4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid
SMILESO=C(O)c1ccc(-c2nc(-c3cccnc3)n[nH]2)cc1
InChIInChI=1S/C14H10N4O2/c19-14(20)10-5-3-9(4-6-10)12-16-13(18-17-12)11-2-1-7-15-8-11/h1-8H,(H,19,20)(H,16,17,18)
InChIKeyWEHIIWRXQQOVSY-UHFFFAOYSA-N
XLogP2.23
TPSA91.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.26
LogP ≤ 52.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid?
The IUPAC name of 4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid (CID 177307387) is 4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid.
What is the SMILES notation for 4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid?
The canonical SMILES for 4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid is O=C(O)c1ccc(-c2nc(-c3cccnc3)n[nH]2)cc1.
What is the InChIKey of 4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid?
The InChIKey is WEHIIWRXQQOVSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O2/c19-14(20)10-5-3-9(4-6-10)12-16-13(18-17-12)11-2-1-7-15-8-11/h1-8H,(H,19,20)(H,16,17,18).
What are the key properties of 4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid?
4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid has a molecular weight of 266.26 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)benzoic acid is sourced from PubChem (CID 177307387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).