C12H9N5Na+ — CID 22564555
sodium 2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)pyridine (PubChem CID 22564555) has the molecular formula C12H9N5Na+ and a molecular weight of 246.23 g/mol. Its IUPAC name is sodium 2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)pyridine.
| Compound Name | sodium 2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)pyridine |
|---|---|
| PubChem CID | 22564555 |
| Molecular Formula | C12H9N5Na+ |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | sodium 2-(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)pyridine |
| SMILES | [Na+].c1ccc(-c2nc(-c3cccnc3)n[nH]2)nc1 |
| InChI | InChI=1S/C12H9N5.Na/c1-2-7-14-10(5-1)12-15-11(16-17-12)9-4-3-6-13-8-9;/h1-8H,(H,15,16,17);/q;+1 |
| InChIKey | CXQFLAUBQNYHTH-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |